6,14-Endoethenotetrahydrooripavine

Names
IUPAC name (4R,7S,7aR,12bR)-7-Methoxy-3-methyl-2,3,4,4a,7,7a-hexahydro-1H-4al5-4a,7-ethano-4,12-methanobenzofuro[3,2-e]isoquinolin-9-ol
Identifiers
3D model (JSmol)	Interactive image
PubChem CID	59866315
InChI InChI=1S/C20H23NO3/c1-21-10-9-20-15-12-3-4-13(22)16(15)24-17(20)19(23-2)7-5-18(20,6-8-19)14(21)11-12/h3-5,7,14,17,22H,6,8-11H2,1-2H3/t14-,17+,18?,19-,20+/m1/s1
SMILES [H][C@]12OC3=C4C(C[C@H]5N(C)CC[C@@]14[C@@]51CC[C@]2(OC)C=C1)=CC=C3O
Properties
Chemical formula	C20H23NO3
Molar mass	325.408 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

6,14-Endoethenotetrahydrooripavine is the central nucleus, or backbone, of a class of morphinan opioids known as the Bentley compounds and may be considered their "privileged scaffold".^[1][2] These include but are not limited to etorphine and buprenorphine. They usually have thebaine or oripavine as their precursor in their syntheses (and are thus termed "thevinols" and "orvinols", respectively).