Terflavin B

Identifiers
CAS Number	103744-86-1 Y
3D model (JSmol)	Interactive image
PubChem CID	44584734
CompTox Dashboard (EPA)	DTXSID00565003
SMILES C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O
Properties
Chemical formula	C34H24O22
Molar mass	784.54 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Y verify (what is YN ?) Infobox references

Terflavin B is an ellagitannin, a type of hydrolysable tannin. It can be found in Myrobalanus chebula (Terminalia chebula), the black chebulic, and in Terminalia catappa, the Indian almond.^[1]

It is formed from a nonahydroxytriphenic acid dilactone and a gallic acid linked to a glucose molecules.