ID's with index2_label|
ATC code | |
---|
|
| | - ix0: Some general note about index_label
- ix2: Some general note about index2_label
|
---|
CAS Number | |
---|
PubChem CID | |
---|
PubChem SID | |
---|
IUPHAR/BPS | |
---|
DrugBank | |
---|
ChemSpider | |
---|
UNII | |
---|
KEGG | |
---|
ChEBI | |
---|
ChEMBL | |
---|
NIAID ChemDB | |
---|
PDB ligand | |
---|
|
3D model (JSmol) | |
---|
ix0: O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
ix2: O=C22[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
|
ix0: InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 YKey:TYZROVQLWOKYKF-ZDUSSCGKSA-N Y
ix2: InChI=1S/22C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2 Key:22ZROVQLWOKYKF-ZDUSSCGKSA-2
| |
ID's with index2_label|
ATC code | |
---|
|
| | - ix0: Some general note about index_label
- ix2: Some general note about index2_label
|
---|
CAS Number | |
---|
PubChem CID | |
---|
PubChem SID | |
---|
IUPHAR/BPS | |
---|
DrugBank | |
---|
ChemSpider | |
---|
UNII | |
---|
KEGG | |
---|
ChEBI | |
---|
ChEMBL | |
---|
NIAID ChemDB | |
---|
PDB ligand | |
---|
|
3D model (JSmol) | |
---|
ix0: O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
ix2: O=C22[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
|
ix0: InChI=1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1 YKey:TYZROVQLWOKYKF-ZDUSSCGKSA-N Y
ix2: InChI=1S/22C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2 Key:22ZROVQLWOKYKF-ZDUSSCGKSA-2
| |