Chemical compound
Hexestrol dipropionate |
|
Other names | Hexestrol 4,4'-dipropionate |
---|
|
[4-[4-(4-propanoyloxyphenyl)hexan-3-yl]phenyl] propanoate
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
|
Formula | C24H30O4 |
---|
Molar mass | 382.500 g·mol−1 |
---|
3D model (JSmol) | |
---|
CCC(C1=CC=C(C=C1)OC(=O)CC)C(CC)C2=CC=C(C=C2)OC(=O)CC
|
InChI=1S/C24H30O4/c1-5-21(17-9-13-19(14-10-17)27-23(25)7-3)22(6-2)18-11-15-20(16-12-18)28-24(26)8-4/h9-16,21-22H,5-8H2,1-4H3 Key:HZLYMVNJKHJFRO-UHFFFAOYSA-N
|
Hexestrol dipropionate (brand name Hexanoestrol, Retalon Oleosum), or hexestrol dipropanoate, is a synthetic, nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol.[1] It is an ester of hexestrol,[1] and has been known since at least 1931.[2] The drug has been used in the past to inhibit lactation in women.[3][4]